C24H33F2N2O3PS — CID 90218503
3-[[4-fluoro-5-[4-[1-(4-fluorophenyl)cyclopentyl]butylsulfanyl]-2-pyridinyl]methylamino]propylphosphonic acid (PubChem CID 90218503) has the molecular formula C24H33F2N2O3PS and a molecular weight of 498.58 g/mol. Its IUPAC name is 3-[[4-fluoro-5-[4-[1-(4-fluorophenyl)cyclopentyl]butylsulfanyl]-2-pyridinyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[4-fluoro-5-[4-[1-(4-fluorophenyl)cyclopentyl]butylsulfanyl]-2-pyridinyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 90218503 |
| Molecular Formula | C24H33F2N2O3PS |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 3-[[4-fluoro-5-[4-[1-(4-fluorophenyl)cyclopentyl]butylsulfanyl]-2-pyridinyl]methylamino]propylphosphonic acid |
| SMILES | O=P(O)(O)CCCNCc1cc(F)c(SCCCCC2(c3ccc(F)cc3)CCCC2)cn1 |
| InChI | InChI=1S/C24H33F2N2O3PS/c25-20-8-6-19(7-9-20)24(10-1-2-11-24)12-3-4-15-33-23-18-28-21(16-22(23)26)17-27-13-5-14-32(29,30)31/h6-9,16,18,27H,1-5,10-15,17H2,(H2,29,30,31) |
| InChIKey | BOVKDKAJSJNYIE-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|