C26H36BrFNO3PS — CID 90218515
3-[[3-bromo-4-[4-[1-(2-fluorophenyl)cyclohexyl]butylsulfanyl]phenyl]methylamino]propylphosphonic acid (PubChem CID 90218515) has the molecular formula C26H36BrFNO3PS and a molecular weight of 572.52 g/mol. Its IUPAC name is 3-[[3-bromo-4-[4-[1-(2-fluorophenyl)cyclohexyl]butylsulfanyl]phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[3-bromo-4-[4-[1-(2-fluorophenyl)cyclohexyl]butylsulfanyl]phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 90218515 |
| Molecular Formula | C26H36BrFNO3PS |
| Molecular Weight | 572.52 g/mol |
| Exact Mass | 571.13 |
| IUPAC Name | 3-[[3-bromo-4-[4-[1-(2-fluorophenyl)cyclohexyl]butylsulfanyl]phenyl]methylamino]propylphosphonic acid |
| SMILES | O=P(O)(O)CCCNCc1ccc(SCCCCC2(c3ccccc3F)CCCCC2)c(Br)c1 |
| InChI | InChI=1S/C26H36BrFNO3PS/c27-23-19-21(20-29-16-8-17-33(30,31)32)11-12-25(23)34-18-7-6-15-26(13-4-1-5-14-26)22-9-2-3-10-24(22)28/h2-3,9-12,19,29H,1,4-8,13-18,20H2,(H2,30,31,32) |
| InChIKey | JORMRBXVSQHPAP-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.52 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|