C21H28BrFNO3PS — CID 90218422
3-[[2-bromo-5-fluoro-4-(5-phenylpentylsulfanyl)phenyl]methylamino]propylphosphonic acid (PubChem CID 90218422) has the molecular formula C21H28BrFNO3PS and a molecular weight of 504.40 g/mol. Its IUPAC name is 3-[[2-bromo-5-fluoro-4-(5-phenylpentylsulfanyl)phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[2-bromo-5-fluoro-4-(5-phenylpentylsulfanyl)phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 90218422 |
| Molecular Formula | C21H28BrFNO3PS |
| Molecular Weight | 504.40 g/mol |
| Exact Mass | 503.07 |
| IUPAC Name | 3-[[2-bromo-5-fluoro-4-(5-phenylpentylsulfanyl)phenyl]methylamino]propylphosphonic acid |
| SMILES | O=P(O)(O)CCCNCc1cc(F)c(SCCCCCc2ccccc2)cc1Br |
| InChI | InChI=1S/C21H28BrFNO3PS/c22-19-15-21(29-13-6-2-5-10-17-8-3-1-4-9-17)20(23)14-18(19)16-24-11-7-12-28(25,26)27/h1,3-4,8-9,14-15,24H,2,5-7,10-13,16H2,(H2,25,26,27) |
| InChIKey | ZGJIJOHGDOIADI-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.40 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|