C21H27F3NO3PS — CID 90218499
3-[[2,5-difluoro-4-[5-(2-fluorophenyl)pentylsulfanyl]phenyl]methylamino]propylphosphonic acid (PubChem CID 90218499) has the molecular formula C21H27F3NO3PS and a molecular weight of 461.49 g/mol. Its IUPAC name is 3-[[2,5-difluoro-4-[5-(2-fluorophenyl)pentylsulfanyl]phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[2,5-difluoro-4-[5-(2-fluorophenyl)pentylsulfanyl]phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 90218499 |
| Molecular Formula | C21H27F3NO3PS |
| Molecular Weight | 461.49 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 3-[[2,5-difluoro-4-[5-(2-fluorophenyl)pentylsulfanyl]phenyl]methylamino]propylphosphonic acid |
| SMILES | O=P(O)(O)CCCNCc1cc(F)c(SCCCCCc2ccccc2F)cc1F |
| InChI | InChI=1S/C21H27F3NO3PS/c22-18-9-4-3-8-16(18)7-2-1-5-12-30-21-14-19(23)17(13-20(21)24)15-25-10-6-11-29(26,27)28/h3-4,8-9,13-14,25H,1-2,5-7,10-12,15H2,(H2,26,27,28) |
| InChIKey | OOMXAYJIZMPZCG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.49 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|