C22H32FN2O3PS — CID 90218645
3-[[5-[5-(2-fluorophenyl)-5-methylhexyl]sulfanyl-2-pyridinyl]methylamino]propylphosphonic acid (PubChem CID 90218645) has the molecular formula C22H32FN2O3PS and a molecular weight of 454.55 g/mol. Its IUPAC name is 3-[[5-[5-(2-fluorophenyl)-5-methylhexyl]sulfanyl-2-pyridinyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[5-[5-(2-fluorophenyl)-5-methylhexyl]sulfanyl-2-pyridinyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 90218645 |
| Molecular Formula | C22H32FN2O3PS |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | 3-[[5-[5-(2-fluorophenyl)-5-methylhexyl]sulfanyl-2-pyridinyl]methylamino]propylphosphonic acid |
| SMILES | CC(C)(CCCCSc1ccc(CNCCCP(=O)(O)O)nc1)c1ccccc1F |
| InChI | InChI=1S/C22H32FN2O3PS/c1-22(2,20-8-3-4-9-21(20)23)12-5-6-15-30-19-11-10-18(25-17-19)16-24-13-7-14-29(26,27)28/h3-4,8-11,17,24H,5-7,12-16H2,1-2H3,(H2,26,27,28) |
| InChIKey | HWGHOZPFYWWJJQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|