C25H34BrFNO3PS — CID 90218824
3-[[3-bromo-4-[4-[1-(2-fluorophenyl)cyclopentyl]butylsulfanyl]phenyl]methylamino]propylphosphonic acid (PubChem CID 90218824) has the molecular formula C25H34BrFNO3PS and a molecular weight of 558.49 g/mol. Its IUPAC name is 3-[[3-bromo-4-[4-[1-(2-fluorophenyl)cyclopentyl]butylsulfanyl]phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[3-bromo-4-[4-[1-(2-fluorophenyl)cyclopentyl]butylsulfanyl]phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 90218824 |
| Molecular Formula | C25H34BrFNO3PS |
| Molecular Weight | 558.49 g/mol |
| Exact Mass | 557.12 |
| IUPAC Name | 3-[[3-bromo-4-[4-[1-(2-fluorophenyl)cyclopentyl]butylsulfanyl]phenyl]methylamino]propylphosphonic acid |
| SMILES | O=P(O)(O)CCCNCc1ccc(SCCCCC2(c3ccccc3F)CCCC2)c(Br)c1 |
| InChI | InChI=1S/C25H34BrFNO3PS/c26-22-18-20(19-28-15-7-16-32(29,30)31)10-11-24(22)33-17-6-5-14-25(12-3-4-13-25)21-8-1-2-9-23(21)27/h1-2,8-11,18,28H,3-7,12-17,19H2,(H2,29,30,31) |
| InChIKey | AKHZUHMQHQIIRO-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.49 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|