2-oxabicyclo[2.2.2]octane-5,6,7,8-tetracarboxylic acid

C11H12O9 — CID 90219212

IUPAC2-oxabicyclo[2.2.2]octane-5,6,7,8-tetracarboxylic acid
SMILESO=C(O)C1C2COC(C1C(=O)O)C(C(=O)O)C2C(=O)O
InChIInChI=1S/C11H12O9/c12-8(13)3-2-1-20-7(5(3)10(16)17)6(11(18)19)4(2)9(14)15/h2-7H,1H2,(H,12,13)(H,14,15)(H,16,17)(H,18,19)
InChIKeyTUJVNLYXFVDGSY-UHFFFAOYSA-N
MW288.21 g/mol
LogP-1.18
Rot. Bonds4

About 2-oxabicyclo[2.2.2]octane-5,6,7,8-tetracarboxylic acid

2-oxabicyclo[2.2.2]octane-5,6,7,8-tetracarboxylic acid (PubChem CID 90219212) has the molecular formula C11H12O9 and a molecular weight of 288.21 g/mol. Its IUPAC name is 2-oxabicyclo[2.2.2]octane-5,6,7,8-tetracarboxylic acid.

Molecular Properties

Compound Name2-oxabicyclo[2.2.2]octane-5,6,7,8-tetracarboxylic acid
PubChem CID90219212
Molecular FormulaC11H12O9
Molecular Weight288.21 g/mol
Exact Mass288.05
IUPAC Name2-oxabicyclo[2.2.2]octane-5,6,7,8-tetracarboxylic acid
SMILESO=C(O)C1C2COC(C1C(=O)O)C(C(=O)O)C2C(=O)O
InChIInChI=1S/C11H12O9/c12-8(13)3-2-1-20-7(5(3)10(16)17)6(11(18)19)4(2)9(14)15/h2-7H,1H2,(H,12,13)(H,14,15)(H,16,17)(H,18,19)
InChIKeyTUJVNLYXFVDGSY-UHFFFAOYSA-N
XLogP-1.18
TPSA158.43 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.21
LogP ≤ 5-1.18
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Analyze 2-oxabicyclo[2.2.2]octane-5,6,7,8-tetracarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-oxabicyclo[2.2.2]octane-5,6,7,8-tetracarboxylic acid?
The IUPAC name of 2-oxabicyclo[2.2.2]octane-5,6,7,8-tetracarboxylic acid (CID 90219212) is 2-oxabicyclo[2.2.2]octane-5,6,7,8-tetracarboxylic acid.
What is the SMILES notation for 2-oxabicyclo[2.2.2]octane-5,6,7,8-tetracarboxylic acid?
The canonical SMILES for 2-oxabicyclo[2.2.2]octane-5,6,7,8-tetracarboxylic acid is O=C(O)C1C2COC(C1C(=O)O)C(C(=O)O)C2C(=O)O.
What is the InChIKey of 2-oxabicyclo[2.2.2]octane-5,6,7,8-tetracarboxylic acid?
The InChIKey is TUJVNLYXFVDGSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O9/c12-8(13)3-2-1-20-7(5(3)10(16)17)6(11(18)19)4(2)9(14)15/h2-7H,1H2,(H,12,13)(H,14,15)(H,16,17)(H,18,19).
What are the key properties of 2-oxabicyclo[2.2.2]octane-5,6,7,8-tetracarboxylic acid?
2-oxabicyclo[2.2.2]octane-5,6,7,8-tetracarboxylic acid has a molecular weight of 288.21 g/mol, XLogP of -1.18, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxabicyclo[2.2.2]octane-5,6,7,8-tetracarboxylic acid is sourced from PubChem (CID 90219212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).