C55H63BN2O2S3 — CID 90223998
4-[5-[9,9-dioctyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]thiophen-2-yl]-7-(5-phenylthiophen-2-yl)-2,1,3-benzothiadiazole (PubChem CID 90223998) has the molecular formula C55H63BN2O2S3 and a molecular weight of 891.13 g/mol. Its IUPAC name is 4-[5-[9,9-dioctyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]thiophen-2-yl]-7-(5-phenylthiophen-2-yl)-2,1,3-benzothiadiazole.
| Compound Name | 4-[5-[9,9-dioctyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]thiophen-2-yl]-7-(5-phenylthiophen-2-yl)-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 90223998 |
| Molecular Formula | C55H63BN2O2S3 |
| Molecular Weight | 891.13 g/mol |
| Exact Mass | 890.41 |
| IUPAC Name | 4-[5-[9,9-dioctyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)fluoren-2-yl]thiophen-2-yl]-7-(5-phenylthiophen-2-yl)-2,1,3-benzothiadiazole |
| SMILES | CCCCCCCCC1(CCCCCCCC)c2cc(B3OC(C)(C)C(C)(C)O3)ccc2-c2ccc(-c3ccc(-c4ccc(-c5ccc(-c6ccccc6)s5)c5nsnc45)s3)cc21 |
| InChI | InChI=1S/C55H63BN2O2S3/c1-7-9-11-13-15-20-34-55(35-21-16-14-12-10-8-2)45-36-39(24-26-41(45)42-27-25-40(37-46(42)55)56-59-53(3,4)54(5,6)60-56)48-31-33-50(62-48)44-29-28-43(51-52(44)58-63-57-51)49-32-30-47(61-49)38-22-18-17-19-23-38/h17-19,22-33,36-37H,7-16,20-21,34-35H2,1-6H3 |
| InChIKey | HNUHGULAXJHUEW-UHFFFAOYSA-N |
| XLogP | 16.55 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.13 |
| LogP ≤ 5 | 16.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|