C23H28FN3O4 — CID 90227685
(5R)-3-(3-fluoro-4-morpholin-4-ylphenyl)-5-[[[(1S)-1-(4-methoxyphenyl)ethyl]amino]methyl]-1,3-oxazolidin-2-one (PubChem CID 90227685) has the molecular formula C23H28FN3O4 and a molecular weight of 429.49 g/mol. Its IUPAC name is (5R)-3-(3-fluoro-4-morpholin-4-ylphenyl)-5-[[[(1S)-1-(4-methoxyphenyl)ethyl]amino]methyl]-1,3-oxazolidin-2-one.
| Compound Name | (5R)-3-(3-fluoro-4-morpholin-4-ylphenyl)-5-[[[(1S)-1-(4-methoxyphenyl)ethyl]amino]methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 90227685 |
| Molecular Formula | C23H28FN3O4 |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | (5R)-3-(3-fluoro-4-morpholin-4-ylphenyl)-5-[[[(1S)-1-(4-methoxyphenyl)ethyl]amino]methyl]-1,3-oxazolidin-2-one |
| SMILES | COc1ccc([C@H](C)NC[C@@H]2CN(c3ccc(N4CCOCC4)c(F)c3)C(=O)O2)cc1 |
| InChI | InChI=1S/C23H28FN3O4/c1-16(17-3-6-19(29-2)7-4-17)25-14-20-15-27(23(28)31-20)18-5-8-22(21(24)13-18)26-9-11-30-12-10-26/h3-8,13,16,20,25H,9-12,14-15H2,1-2H3/t16-,20+/m0/s1 |
| InChIKey | ZIACZOFYERVHJE-OXJNMPFZSA-N |
| XLogP | 3.35 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|