C20H17N5O2 — CID 90233570
3-[5-[2-(5-amino-2-methylanilino)-1,3-oxazol-5-yl]-3-pyridinyl]-1H-pyridin-2-one (PubChem CID 90233570) has the molecular formula C20H17N5O2 and a molecular weight of 359.39 g/mol. Its IUPAC name is 3-[5-[2-(5-amino-2-methylanilino)-1,3-oxazol-5-yl]-3-pyridinyl]-1H-pyridin-2-one.
| Compound Name | 3-[5-[2-(5-amino-2-methylanilino)-1,3-oxazol-5-yl]-3-pyridinyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 90233570 |
| Molecular Formula | C20H17N5O2 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 3-[5-[2-(5-amino-2-methylanilino)-1,3-oxazol-5-yl]-3-pyridinyl]-1H-pyridin-2-one |
| SMILES | Cc1ccc(N)cc1Nc1ncc(-c2cncc(-c3ccc[nH]c3=O)c2)o1 |
| InChI | InChI=1S/C20H17N5O2/c1-12-4-5-15(21)8-17(12)25-20-24-11-18(27-20)14-7-13(9-22-10-14)16-3-2-6-23-19(16)26/h2-11H,21H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | HPSALCJANNPGMS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 109.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|