C12H20BN3O2 — CID 90234004
4-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine (PubChem CID 90234004) has the molecular formula C12H20BN3O2 and a molecular weight of 249.12 g/mol. Its IUPAC name is 4-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine.
| Compound Name | 4-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 90234004 |
| Molecular Formula | C12H20BN3O2 |
| Molecular Weight | 249.12 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 4-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-amine |
| SMILES | CCc1nc(N)ncc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C12H20BN3O2/c1-6-9-8(7-15-10(14)16-9)13-17-11(2,3)12(4,5)18-13/h7H,6H2,1-5H3,(H2,14,15,16) |
| InChIKey | RXEYFUGOFSMZDE-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.12 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|