C32H46N2O4 — CID 90234358
(4R,4aS,6aR,6aR,6bR,8aR,12aR,14aR,14bS)-11-cyano-N-methoxy-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-3,4,4a,5,6,6a,7,8,8a,13,14a,14b-dodecahydro-1H-picene-4-carboxamide (PubChem CID 90234358) has the molecular formula C32H46N2O4 and a molecular weight of 522.73 g/mol. Its IUPAC name is (4R,4aS,6aR,6aR,6bR,8aR,12aR,14aR,14bS)-11-cyano-N-methoxy-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-3,4,4a,5,6,6a,7,8,8a,13,14a,14b-dodecahydro-1H-picene-4-carboxamide.
| Compound Name | (4R,4aS,6aR,6aR,6bR,8aR,12aR,14aR,14bS)-11-cyano-N-methoxy-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-3,4,4a,5,6,6a,7,8,8a,13,14a,14b-dodecahydro-1H-picene-4-carboxamide |
|---|---|
| PubChem CID | 90234358 |
| Molecular Formula | C32H46N2O4 |
| Molecular Weight | 522.73 g/mol |
| Exact Mass | 522.35 |
| IUPAC Name | (4R,4aS,6aR,6aR,6bR,8aR,12aR,14aR,14bS)-11-cyano-N-methoxy-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-3,4,4a,5,6,6a,7,8,8a,13,14a,14b-dodecahydro-1H-picene-4-carboxamide |
| SMILES | CONC(=O)[C@@H]1CC(C)(C)C[C@H]2[C@@H]1CC[C@]1(C)[C@@H]2C(=O)C[C@@H]2[C@@]3(C)C=C(C#N)C(=O)C(C)(C)[C@@H]3CC[C@]21C |
| InChI | InChI=1S/C32H46N2O4/c1-28(2)15-20-19(21(16-28)27(37)34-38-8)9-11-32(7)25(20)22(35)13-24-30(5)14-18(17-33)26(36)29(3,4)23(30)10-12-31(24,32)6/h14,19-21,23-25H,9-13,15-16H2,1-8H3,(H,34,37)/t19-,20-,21+,23-,24+,25-,30-,31+,32+/m0/s1 |
| InChIKey | ZENWMRTWXZPUJS-ALXWDVODSA-N |
| XLogP | 5.82 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.73 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|