C9H14O6 — CID 90239143
(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxynon-8-ynal (PubChem CID 90239143) has the molecular formula C9H14O6 and a molecular weight of 218.20 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxynon-8-ynal.
| Compound Name | (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxynon-8-ynal |
|---|---|
| PubChem CID | 90239143 |
| Molecular Formula | C9H14O6 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | (2R,3S,4S,5R)-2,3,4,5,6-pentahydroxynon-8-ynal |
| SMILES | C#CCC(O)[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)C=O |
| InChI | InChI=1S/C9H14O6/c1-2-3-5(11)7(13)9(15)8(14)6(12)4-10/h1,4-9,11-15H,3H2/t5?,6-,7+,8+,9-/m0/s1 |
| InChIKey | DBJCAZPRELENEO-YOBQRZKDSA-N |
| XLogP | -2.99 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|