C14H14N4O4 — CID 902403
(4R)-4-(4-methoxyphenyl)-3-methyl-5-nitro-2,4-dihydropyrano[2,3-c]pyrazol-6-amine (PubChem CID 902403) has the molecular formula C14H14N4O4 and a molecular weight of 302.29 g/mol. Its IUPAC name is (4R)-4-(4-methoxyphenyl)-3-methyl-5-nitro-2,4-dihydropyrano[2,3-c]pyrazol-6-amine.
| Compound Name | (4R)-4-(4-methoxyphenyl)-3-methyl-5-nitro-2,4-dihydropyrano[2,3-c]pyrazol-6-amine |
|---|---|
| PubChem CID | 902403 |
| Molecular Formula | C14H14N4O4 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | (4R)-4-(4-methoxyphenyl)-3-methyl-5-nitro-2,4-dihydropyrano[2,3-c]pyrazol-6-amine |
| SMILES | COc1ccc([C@H]2C([N+](=O)[O-])=C(N)Oc3n[nH]c(C)c32)cc1 |
| InChI | InChI=1S/C14H14N4O4/c1-7-10-11(8-3-5-9(21-2)6-4-8)12(18(19)20)13(15)22-14(10)17-16-7/h3-6,11H,15H2,1-2H3,(H,16,17)/t11-/m1/s1 |
| InChIKey | YXHFZODRYRFMBM-LLVKDONJSA-N |
| XLogP | 1.66 |
| TPSA | 116.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|