C15H16N4O4 — CID 102138517
4-(4-methoxyphenyl)-N,3-dimethyl-5-nitro-2,4-dihydropyrano[2,3-c]pyrazol-6-amine (PubChem CID 102138517) has the molecular formula C15H16N4O4 and a molecular weight of 316.32 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-N,3-dimethyl-5-nitro-2,4-dihydropyrano[2,3-c]pyrazol-6-amine.
| Compound Name | 4-(4-methoxyphenyl)-N,3-dimethyl-5-nitro-2,4-dihydropyrano[2,3-c]pyrazol-6-amine |
|---|---|
| PubChem CID | 102138517 |
| Molecular Formula | C15H16N4O4 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 4-(4-methoxyphenyl)-N,3-dimethyl-5-nitro-2,4-dihydropyrano[2,3-c]pyrazol-6-amine |
| SMILES | CNC1=C([N+](=O)[O-])C(c2ccc(OC)cc2)c2c(n[nH]c2C)O1 |
| InChI | InChI=1S/C15H16N4O4/c1-8-11-12(9-4-6-10(22-3)7-5-9)13(19(20)21)15(16-2)23-14(11)18-17-8/h4-7,12,16H,1-3H3,(H,17,18) |
| InChIKey | BPZIURRBGITGKU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|