C21H17N9O3S — CID 16719411
5-amino-1-[6,12-dimethyl-8-(4-nitrophenyl)-2-oxa-4,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(13),3,6,9,11-pentaen-10-yl]-3-methylsulfanylpyrazole-4-carbonitrile (PubChem CID 16719411) has the molecular formula C21H17N9O3S and a molecular weight of 475.49 g/mol. Its IUPAC name is 5-amino-1-[6,12-dimethyl-8-(4-nitrophenyl)-2-oxa-4,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(13),3,6,9,11-pentaen-10-yl]-3-methylsulfanylpyrazole-4-carbonitrile.
| Compound Name | 5-amino-1-[6,12-dimethyl-8-(4-nitrophenyl)-2-oxa-4,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(13),3,6,9,11-pentaen-10-yl]-3-methylsulfanylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 16719411 |
| Molecular Formula | C21H17N9O3S |
| Molecular Weight | 475.49 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 5-amino-1-[6,12-dimethyl-8-(4-nitrophenyl)-2-oxa-4,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(13),3,6,9,11-pentaen-10-yl]-3-methylsulfanylpyrazole-4-carbonitrile |
| SMILES | CSc1nn(-c2nc(C)nc3c2C(c2ccc([N+](=O)[O-])cc2)c2c(n[nH]c2C)O3)c(N)c1C#N |
| InChI | InChI=1S/C21H17N9O3S/c1-9-14-15(11-4-6-12(7-5-11)30(31)32)16-18(29-17(23)13(8-22)21(28-29)34-3)24-10(2)25-19(16)33-20(14)27-26-9/h4-7,15H,23H2,1-3H3,(H,26,27) |
| InChIKey | WSJCRHDESYIVIG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 174.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|