C12H20N2O4 — CID 90240667
5-amino-2-[[(E)-2-methylhex-2-enoyl]amino]-5-oxopentanoic acid (PubChem CID 90240667) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is 5-amino-2-[[(E)-2-methylhex-2-enoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[(E)-2-methylhex-2-enoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 90240667 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 5-amino-2-[[(E)-2-methylhex-2-enoyl]amino]-5-oxopentanoic acid |
| SMILES | CCC/C=C(\C)C(=O)NC(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C12H20N2O4/c1-3-4-5-8(2)11(16)14-9(12(17)18)6-7-10(13)15/h5,9H,3-4,6-7H2,1-2H3,(H2,13,15)(H,14,16)(H,17,18)/b8-5+ |
| InChIKey | SSZJPEOZVLEULC-VMPITWQZSA-N |
| XLogP | 0.57 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|