C17H30N2O4 — CID 90241030
(2S)-5-amino-2-(2-methylundec-2-enoylamino)-5-oxopentanoic acid (PubChem CID 90241030) has the molecular formula C17H30N2O4 and a molecular weight of 326.44 g/mol. Its IUPAC name is (2S)-5-amino-2-(2-methylundec-2-enoylamino)-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-(2-methylundec-2-enoylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 90241030 |
| Molecular Formula | C17H30N2O4 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | (2S)-5-amino-2-(2-methylundec-2-enoylamino)-5-oxopentanoic acid |
| SMILES | CCCCCCCCC=C(C)C(=O)N[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C17H30N2O4/c1-3-4-5-6-7-8-9-10-13(2)16(21)19-14(17(22)23)11-12-15(18)20/h10,14H,3-9,11-12H2,1-2H3,(H2,18,20)(H,19,21)(H,22,23)/t14-/m0/s1 |
| InChIKey | FXFHLAYUHZIRFN-AWEZNQCLSA-N |
| XLogP | 2.52 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|