C11H18N2O4 — CID 90241552
5-amino-2-[[(E)-hex-2-enoyl]amino]-5-oxopentanoic acid (PubChem CID 90241552) has the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. Its IUPAC name is 5-amino-2-[[(E)-hex-2-enoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[(E)-hex-2-enoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 90241552 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 5-amino-2-[[(E)-hex-2-enoyl]amino]-5-oxopentanoic acid |
| SMILES | CCC/C=C/C(=O)NC(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C11H18N2O4/c1-2-3-4-5-10(15)13-8(11(16)17)6-7-9(12)14/h4-5,8H,2-3,6-7H2,1H3,(H2,12,14)(H,13,15)(H,16,17)/b5-4+ |
| InChIKey | GHRGAPQBVGNLRH-SNAWJCMRSA-N |
| XLogP | 0.18 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|