C13H15NO2S — CID 90242663
4-hydroxy-N,N-bis(prop-2-enyl)-2-sulfanylbenzamide (PubChem CID 90242663) has the molecular formula C13H15NO2S and a molecular weight of 249.34 g/mol. Its IUPAC name is 4-hydroxy-N,N-bis(prop-2-enyl)-2-sulfanylbenzamide.
| Compound Name | 4-hydroxy-N,N-bis(prop-2-enyl)-2-sulfanylbenzamide |
|---|---|
| PubChem CID | 90242663 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 4-hydroxy-N,N-bis(prop-2-enyl)-2-sulfanylbenzamide |
| SMILES | C=CCN(CC=C)C(=O)c1ccc(O)cc1S |
| InChI | InChI=1S/C13H15NO2S/c1-3-7-14(8-4-2)13(16)11-6-5-10(15)9-12(11)17/h3-6,9,15,17H,1-2,7-8H2 |
| InChIKey | DRCYAZSIWWAUPC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|