C4H3N5 — CID 90245641
triazolo[5,1-c][1,2,4]triazine (PubChem CID 90245641) has the molecular formula C4H3N5 and a molecular weight of 121.10 g/mol. Its IUPAC name is triazolo[5,1-c][1,2,4]triazine.
| Compound Name | triazolo[5,1-c][1,2,4]triazine |
|---|---|
| PubChem CID | 90245641 |
| Molecular Formula | C4H3N5 |
| Molecular Weight | 121.10 g/mol |
| Exact Mass | 121.04 |
| IUPAC Name | triazolo[5,1-c][1,2,4]triazine |
| SMILES | c1cn2nncc2nn1 |
| InChI | InChI=1S/C4H3N5/c1-2-9-4(7-5-1)3-6-8-9/h1-3H |
| InChIKey | XUSLWYMNMLZLCH-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.10 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |