About N,N-dimethylimidazo[5,1-c][1,2,4]triazin-6-amine
N,N-dimethylimidazo[5,1-c][1,2,4]triazin-6-amine (PubChem CID 134334517) has the molecular formula C7H9N5
and a molecular weight of 163.18 g/mol. Its IUPAC name is N,N-dimethylimidazo[5,1-c][1,2,4]triazin-6-amine.
Analyze N,N-dimethylimidazo[5,1-c][1,2,4]triazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylimidazo[5,1-c][1,2,4]triazin-6-amine?
The IUPAC name of N,N-dimethylimidazo[5,1-c][1,2,4]triazin-6-amine (CID 134334517) is N,N-dimethylimidazo[5,1-c][1,2,4]triazin-6-amine.
What is the SMILES notation for N,N-dimethylimidazo[5,1-c][1,2,4]triazin-6-amine?
The canonical SMILES for N,N-dimethylimidazo[5,1-c][1,2,4]triazin-6-amine is CN(C)c1ncc2nnccn12.
What is the InChIKey of N,N-dimethylimidazo[5,1-c][1,2,4]triazin-6-amine?
The InChIKey is XIIGVKVLTLZNCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N5/c1-11(2)7-8-5-6-10-9-3-4-12(6)7/h3-5H,1-2H3.
What are the key properties of N,N-dimethylimidazo[5,1-c][1,2,4]triazin-6-amine?
N,N-dimethylimidazo[5,1-c][1,2,4]triazin-6-amine has a molecular weight of 163.18 g/mol, XLogP of 0.19, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylimidazo[5,1-c][1,2,4]triazin-6-amine is sourced from PubChem (CID 134334517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).