About 5-bromo-6-methylimidazo[1,2-a]pyrazine;hydrobromide
5-bromo-6-methylimidazo[1,2-a]pyrazine;hydrobromide (PubChem CID 139593178) has the molecular formula C7H7Br2N3
and a molecular weight of 292.96 g/mol. Its IUPAC name is 5-bromo-6-methylimidazo[1,2-a]pyrazine;hydrobromide.
Analyze 5-bromo-6-methylimidazo[1,2-a]pyrazine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-6-methylimidazo[1,2-a]pyrazine;hydrobromide?
The IUPAC name of 5-bromo-6-methylimidazo[1,2-a]pyrazine;hydrobromide (CID 139593178) is 5-bromo-6-methylimidazo[1,2-a]pyrazine;hydrobromide.
What is the SMILES notation for 5-bromo-6-methylimidazo[1,2-a]pyrazine;hydrobromide?
The canonical SMILES for 5-bromo-6-methylimidazo[1,2-a]pyrazine;hydrobromide is Br.Cc1ncc2nccn2c1Br.
What is the InChIKey of 5-bromo-6-methylimidazo[1,2-a]pyrazine;hydrobromide?
The InChIKey is UCYWOMWQDHKMHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrN3.BrH/c1-5-7(8)11-3-2-9-6(11)4-10-5;/h2-4H,1H3;1H.
What are the key properties of 5-bromo-6-methylimidazo[1,2-a]pyrazine;hydrobromide?
5-bromo-6-methylimidazo[1,2-a]pyrazine;hydrobromide has a molecular weight of 292.96 g/mol, XLogP of 2.38, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-6-methylimidazo[1,2-a]pyrazine;hydrobromide is sourced from PubChem (CID 139593178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).