About imidazo[1,2-a]quinoxaline;hydrochloride
imidazo[1,2-a]quinoxaline;hydrochloride (PubChem CID 141277091) has the molecular formula C10H8ClN3
and a molecular weight of 205.65 g/mol. Its IUPAC name is imidazo[1,2-a]quinoxaline;hydrochloride.
Molecular Properties
| Compound Name | imidazo[1,2-a]quinoxaline;hydrochloride |
| PubChem CID | 141277091 |
| Molecular Formula | C10H8ClN3 |
| Molecular Weight | 205.65 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | imidazo[1,2-a]quinoxaline;hydrochloride |
| SMILES | Cl.c1ccc2c(c1)ncc1nccn12 |
| InChI | InChI=1S/C10H7N3.ClH/c1-2-4-9-8(3-1)12-7-10-11-5-6-13(9)10;/h1-7H;1H |
| InChIKey | ZYNRPESGSOVSPE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.65 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze imidazo[1,2-a]quinoxaline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[1,2-a]quinoxaline;hydrochloride?
The IUPAC name of imidazo[1,2-a]quinoxaline;hydrochloride (CID 141277091) is imidazo[1,2-a]quinoxaline;hydrochloride.
What is the SMILES notation for imidazo[1,2-a]quinoxaline;hydrochloride?
The canonical SMILES for imidazo[1,2-a]quinoxaline;hydrochloride is Cl.c1ccc2c(c1)ncc1nccn12.
What is the InChIKey of imidazo[1,2-a]quinoxaline;hydrochloride?
The InChIKey is ZYNRPESGSOVSPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N3.ClH/c1-2-4-9-8(3-1)12-7-10-11-5-6-13(9)10;/h1-7H;1H.
What are the key properties of imidazo[1,2-a]quinoxaline;hydrochloride?
imidazo[1,2-a]quinoxaline;hydrochloride has a molecular weight of 205.65 g/mol, XLogP of 2.30, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[1,2-a]quinoxaline;hydrochloride is sourced from PubChem (CID 141277091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).