C10H8N4O — CID 141273942
2,5,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-11-ylmethanol (PubChem CID 141273942) has the molecular formula C10H8N4O and a molecular weight of 200.20 g/mol. Its IUPAC name is 2,5,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-11-ylmethanol.
| Compound Name | 2,5,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-11-ylmethanol |
|---|---|
| PubChem CID | 141273942 |
| Molecular Formula | C10H8N4O |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 2,5,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-11-ylmethanol |
| SMILES | OCc1cnc2c(c1)ncc1nccn12 |
| InChI | InChI=1S/C10H8N4O/c15-6-7-3-8-10(13-4-7)14-2-1-11-9(14)5-12-8/h1-5,15H,6H2 |
| InChIKey | AVANGDWZCKGIDX-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 63.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |