C5H6N4O — CID 69459986
4-methoxyimidazo[1,2-c]triazole (PubChem CID 69459986) has the molecular formula C5H6N4O and a molecular weight of 138.13 g/mol. Its IUPAC name is 4-methoxyimidazo[1,2-c]triazole.
| Compound Name | 4-methoxyimidazo[1,2-c]triazole |
|---|---|
| PubChem CID | 69459986 |
| Molecular Formula | C5H6N4O |
| Molecular Weight | 138.13 g/mol |
| Exact Mass | 138.05 |
| IUPAC Name | 4-methoxyimidazo[1,2-c]triazole |
| SMILES | COn1ccn2nncc12 |
| InChI | InChI=1S/C5H6N4O/c1-10-9-3-2-8-5(9)4-6-7-8/h2-4H,1H3 |
| InChIKey | AYVFNJNPDYCHLN-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 44.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.13 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |