C5H7N5O — CID 69461403
4-methoxyimidazo[1,2-c]triazol-6-amine (PubChem CID 69461403) has the molecular formula C5H7N5O and a molecular weight of 153.15 g/mol. Its IUPAC name is 4-methoxyimidazo[1,2-c]triazol-6-amine.
| Compound Name | 4-methoxyimidazo[1,2-c]triazol-6-amine |
|---|---|
| PubChem CID | 69461403 |
| Molecular Formula | C5H7N5O |
| Molecular Weight | 153.15 g/mol |
| Exact Mass | 153.07 |
| IUPAC Name | 4-methoxyimidazo[1,2-c]triazol-6-amine |
| SMILES | COn1cc(N)n2nncc12 |
| InChI | InChI=1S/C5H7N5O/c1-11-9-3-4(6)10-5(9)2-7-8-10/h2-3H,6H2,1H3 |
| InChIKey | LAEOYWUBOPAQBW-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.15 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |