About 4-hydroxyimidazo[1,2-c]triazol-6-amine
4-hydroxyimidazo[1,2-c]triazol-6-amine (PubChem CID 55285931) has the molecular formula C4H5N5O
and a molecular weight of 139.12 g/mol. Its IUPAC name is 4-hydroxyimidazo[1,2-c]triazol-6-amine.
Molecular Properties
| Compound Name | 4-hydroxyimidazo[1,2-c]triazol-6-amine |
| PubChem CID | 55285931 |
| Molecular Formula | C4H5N5O |
| Molecular Weight | 139.12 g/mol |
| Exact Mass | 139.05 |
| IUPAC Name | 4-hydroxyimidazo[1,2-c]triazol-6-amine |
| SMILES | Nc1cn(O)c2cnnn12 |
| InChI | InChI=1S/C4H5N5O/c5-3-2-8(10)4-1-6-7-9(3)4/h1-2,10H,5H2 |
| InChIKey | GRSLQONXPITTOW-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 81.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.12 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxyimidazo[1,2-c]triazol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxyimidazo[1,2-c]triazol-6-amine?
The IUPAC name of 4-hydroxyimidazo[1,2-c]triazol-6-amine (CID 55285931) is 4-hydroxyimidazo[1,2-c]triazol-6-amine.
What is the SMILES notation for 4-hydroxyimidazo[1,2-c]triazol-6-amine?
The canonical SMILES for 4-hydroxyimidazo[1,2-c]triazol-6-amine is Nc1cn(O)c2cnnn12.
What is the InChIKey of 4-hydroxyimidazo[1,2-c]triazol-6-amine?
The InChIKey is GRSLQONXPITTOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N5O/c5-3-2-8(10)4-1-6-7-9(3)4/h1-2,10H,5H2.
What are the key properties of 4-hydroxyimidazo[1,2-c]triazol-6-amine?
4-hydroxyimidazo[1,2-c]triazol-6-amine has a molecular weight of 139.12 g/mol, XLogP of -0.65, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxyimidazo[1,2-c]triazol-6-amine is sourced from PubChem (CID 55285931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).