C71H59N — CID 90249372
1,6-bis(9,9-dimethylfluoren-2-yl)-9-methyl-3,8-bis[3-methyl-4-(2-methylphenyl)phenyl]carbazole (PubChem CID 90249372) has the molecular formula C71H59N and a molecular weight of 926.26 g/mol. Its IUPAC name is 1,6-bis(9,9-dimethylfluoren-2-yl)-9-methyl-3,8-bis[3-methyl-4-(2-methylphenyl)phenyl]carbazole.
| Compound Name | 1,6-bis(9,9-dimethylfluoren-2-yl)-9-methyl-3,8-bis[3-methyl-4-(2-methylphenyl)phenyl]carbazole |
|---|---|
| PubChem CID | 90249372 |
| Molecular Formula | C71H59N |
| Molecular Weight | 926.26 g/mol |
| Exact Mass | 925.46 |
| IUPAC Name | 1,6-bis(9,9-dimethylfluoren-2-yl)-9-methyl-3,8-bis[3-methyl-4-(2-methylphenyl)phenyl]carbazole |
| SMILES | Cc1ccccc1-c1ccc(-c2cc(-c3ccc4c(c3)C(C)(C)c3ccccc3-4)c3c(c2)c2cc(-c4ccc5c(c4)C(C)(C)c4ccccc4-5)cc(-c4ccc(-c5ccccc5C)c(C)c4)c2n3C)cc1C |
| InChI | InChI=1S/C71H59N/c1-42-18-10-12-20-52(42)54-30-26-46(34-44(54)3)50-36-61(49-29-33-59-57-23-15-17-25-65(57)71(7,8)67(59)41-49)69-62(38-50)63-39-51(47-27-32-58-56-22-14-16-24-64(56)70(5,6)66(58)40-47)37-60(68(63)72(69)9)48-28-31-55(45(4)35-48)53-21-13-11-19-43(53)2/h10-41H,1-9H3 |
| InChIKey | CRVBXFHNPNEPCC-UHFFFAOYSA-N |
| XLogP | 19.18 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 926.26 |
| LogP ≤ 5 | 19.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |