C18H28NO7P — CID 90249485
4-diethoxyphosphoryloxybutyl 2-acetamido-4-methylbenzoate (PubChem CID 90249485) has the molecular formula C18H28NO7P and a molecular weight of 401.40 g/mol. Its IUPAC name is 4-diethoxyphosphoryloxybutyl 2-acetamido-4-methylbenzoate.
| Compound Name | 4-diethoxyphosphoryloxybutyl 2-acetamido-4-methylbenzoate |
|---|---|
| PubChem CID | 90249485 |
| Molecular Formula | C18H28NO7P |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 4-diethoxyphosphoryloxybutyl 2-acetamido-4-methylbenzoate |
| SMILES | CCOP(=O)(OCC)OCCCCOC(=O)c1ccc(C)cc1NC(C)=O |
| InChI | InChI=1S/C18H28NO7P/c1-5-24-27(22,25-6-2)26-12-8-7-11-23-18(21)16-10-9-14(3)13-17(16)19-15(4)20/h9-10,13H,5-8,11-12H2,1-4H3,(H,19,20) |
| InChIKey | SZPNALZHMQPBCK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|