C25H22N4O2S — CID 90250956
[2-[6-(furan-2-yl)pyrazin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-thiophen-2-ylphenyl)methanone (PubChem CID 90250956) has the molecular formula C25H22N4O2S and a molecular weight of 442.54 g/mol. Its IUPAC name is [2-[6-(furan-2-yl)pyrazin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-thiophen-2-ylphenyl)methanone.
| Compound Name | [2-[6-(furan-2-yl)pyrazin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-thiophen-2-ylphenyl)methanone |
|---|---|
| PubChem CID | 90250956 |
| Molecular Formula | C25H22N4O2S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | [2-[6-(furan-2-yl)pyrazin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2-thiophen-2-ylphenyl)methanone |
| SMILES | O=C(c1ccccc1-c1cccs1)N1CC2CN(c3cncc(-c4ccco4)n3)CC2C1 |
| InChI | InChI=1S/C25H22N4O2S/c30-25(20-6-2-1-5-19(20)23-8-4-10-32-23)29-15-17-13-28(14-18(17)16-29)24-12-26-11-21(27-24)22-7-3-9-31-22/h1-12,17-18H,13-16H2 |
| InChIKey | BHIDTEVNGPOCRU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |