C30H33F3N6O2 — CID 90252396
N-[4-[(1R,3R,4S,5S)-3-amino-4-methoxy-5-methylcyclohexyl]-3-pyridinyl]-2-[2,6-difluoro-4-(4-fluorooxan-4-yl)phenyl]imidazo[1,5-b]pyridazin-7-amine (PubChem CID 90252396) has the molecular formula C30H33F3N6O2 and a molecular weight of 566.63 g/mol. Its IUPAC name is N-[4-[(1R,3R,4S,5S)-3-amino-4-methoxy-5-methylcyclohexyl]-3-pyridinyl]-2-[2,6-difluoro-4-(4-fluorooxan-4-yl)phenyl]imidazo[1,5-b]pyridazin-7-amine.
| Compound Name | N-[4-[(1R,3R,4S,5S)-3-amino-4-methoxy-5-methylcyclohexyl]-3-pyridinyl]-2-[2,6-difluoro-4-(4-fluorooxan-4-yl)phenyl]imidazo[1,5-b]pyridazin-7-amine |
|---|---|
| PubChem CID | 90252396 |
| Molecular Formula | C30H33F3N6O2 |
| Molecular Weight | 566.63 g/mol |
| Exact Mass | 566.26 |
| IUPAC Name | N-[4-[(1R,3R,4S,5S)-3-amino-4-methoxy-5-methylcyclohexyl]-3-pyridinyl]-2-[2,6-difluoro-4-(4-fluorooxan-4-yl)phenyl]imidazo[1,5-b]pyridazin-7-amine |
| SMILES | CO[C@@H]1[C@H](N)C[C@H](c2ccncc2Nc2ncc3ccc(-c4c(F)cc(C5(F)CCOCC5)cc4F)nn23)C[C@@H]1C |
| InChI | InChI=1S/C30H33F3N6O2/c1-17-11-18(12-24(34)28(17)40-2)21-5-8-35-16-26(21)37-29-36-15-20-3-4-25(38-39(20)29)27-22(31)13-19(14-23(27)32)30(33)6-9-41-10-7-30/h3-5,8,13-18,24,28H,6-7,9-12,34H2,1-2H3,(H,36,37)/t17-,18+,24+,28-/m0/s1 |
| InChIKey | HJGOTGLGKDHQMQ-SEHDDTEPSA-N |
| XLogP | 5.64 |
| TPSA | 99.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.63 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |