C12H11FN2O2S2 — CID 90260927
4-(3-fluoro-4-hydroxyphenyl)-N-methyl-N-(sulfanylmethyl)-1,3-thiazole-2-carboxamide (PubChem CID 90260927) has the molecular formula C12H11FN2O2S2 and a molecular weight of 298.36 g/mol. Its IUPAC name is 4-(3-fluoro-4-hydroxyphenyl)-N-methyl-N-(sulfanylmethyl)-1,3-thiazole-2-carboxamide.
| Compound Name | 4-(3-fluoro-4-hydroxyphenyl)-N-methyl-N-(sulfanylmethyl)-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 90260927 |
| Molecular Formula | C12H11FN2O2S2 |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 4-(3-fluoro-4-hydroxyphenyl)-N-methyl-N-(sulfanylmethyl)-1,3-thiazole-2-carboxamide |
| SMILES | CN(CS)C(=O)c1nc(-c2ccc(O)c(F)c2)cs1 |
| InChI | InChI=1S/C12H11FN2O2S2/c1-15(6-18)12(17)11-14-9(5-19-11)7-2-3-10(16)8(13)4-7/h2-5,16,18H,6H2,1H3 |
| InChIKey | WPZJERURBRGZPK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|