C14H12F3N3 — CID 90267967
3-ethyl-7-[5-(trifluoromethyl)-2-pyridinyl]-3,7-diazatetracyclo[3.3.0.02,8.04,6]oct-1(5)-ene (PubChem CID 90267967) has the molecular formula C14H12F3N3 and a molecular weight of 279.27 g/mol. Its IUPAC name is 3-ethyl-7-[5-(trifluoromethyl)-2-pyridinyl]-3,7-diazatetracyclo[3.3.0.02,8.04,6]oct-1(5)-ene.
| Compound Name | 3-ethyl-7-[5-(trifluoromethyl)-2-pyridinyl]-3,7-diazatetracyclo[3.3.0.02,8.04,6]oct-1(5)-ene |
|---|---|
| PubChem CID | 90267967 |
| Molecular Formula | C14H12F3N3 |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 3-ethyl-7-[5-(trifluoromethyl)-2-pyridinyl]-3,7-diazatetracyclo[3.3.0.02,8.04,6]oct-1(5)-ene |
| SMILES | CCN1C2C3=C4C1C4N(c1ccc(C(F)(F)F)cn1)C32 |
| InChI | InChI=1S/C14H12F3N3/c1-2-19-10-8-9-11(19)13(9)20(12(8)10)7-4-3-6(5-18-7)14(15,16)17/h3-5,10-13H,2H2,1H3 |
| InChIKey | JQKPWXZCFZBZLN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|