C25H41N5O2 — CID 90272435
N-[4-[2-[4-[2-tert-butyl-6-(3-hydroxycyclobutyl)pyrimidin-4-yl]piperazin-1-yl]ethyl]cyclohexyl]formamide (PubChem CID 90272435) has the molecular formula C25H41N5O2 and a molecular weight of 443.64 g/mol. Its IUPAC name is N-[4-[2-[4-[2-tert-butyl-6-(3-hydroxycyclobutyl)pyrimidin-4-yl]piperazin-1-yl]ethyl]cyclohexyl]formamide.
| Compound Name | N-[4-[2-[4-[2-tert-butyl-6-(3-hydroxycyclobutyl)pyrimidin-4-yl]piperazin-1-yl]ethyl]cyclohexyl]formamide |
|---|---|
| PubChem CID | 90272435 |
| Molecular Formula | C25H41N5O2 |
| Molecular Weight | 443.64 g/mol |
| Exact Mass | 443.33 |
| IUPAC Name | N-[4-[2-[4-[2-tert-butyl-6-(3-hydroxycyclobutyl)pyrimidin-4-yl]piperazin-1-yl]ethyl]cyclohexyl]formamide |
| SMILES | CC(C)(C)c1nc(C2CC(O)C2)cc(N2CCN(CCC3CCC(NC=O)CC3)CC2)n1 |
| InChI | InChI=1S/C25H41N5O2/c1-25(2,3)24-27-22(19-14-21(32)15-19)16-23(28-24)30-12-10-29(11-13-30)9-8-18-4-6-20(7-5-18)26-17-31/h16-21,32H,4-15H2,1-3H3,(H,26,31) |
| InChIKey | MAJYTEMGKCYMHL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.64 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|