C29H33N7O2 — CID 90272927
(E)-3-[2-amino-4-methyl-6-[3-(5-methyl-4-oxo-3-phenylquinazolin-2-yl)propylamino]pyrimidin-5-yl]-N-propan-2-ylprop-2-enamide (PubChem CID 90272927) has the molecular formula C29H33N7O2 and a molecular weight of 511.63 g/mol. Its IUPAC name is (E)-3-[2-amino-4-methyl-6-[3-(5-methyl-4-oxo-3-phenylquinazolin-2-yl)propylamino]pyrimidin-5-yl]-N-propan-2-ylprop-2-enamide.
| Compound Name | (E)-3-[2-amino-4-methyl-6-[3-(5-methyl-4-oxo-3-phenylquinazolin-2-yl)propylamino]pyrimidin-5-yl]-N-propan-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 90272927 |
| Molecular Formula | C29H33N7O2 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.27 |
| IUPAC Name | (E)-3-[2-amino-4-methyl-6-[3-(5-methyl-4-oxo-3-phenylquinazolin-2-yl)propylamino]pyrimidin-5-yl]-N-propan-2-ylprop-2-enamide |
| SMILES | Cc1nc(N)nc(NCCCc2nc3cccc(C)c3c(=O)n2-c2ccccc2)c1/C=C/C(=O)NC(C)C |
| InChI | InChI=1S/C29H33N7O2/c1-18(2)32-25(37)16-15-22-20(4)33-29(30)35-27(22)31-17-9-14-24-34-23-13-8-10-19(3)26(23)28(38)36(24)21-11-6-5-7-12-21/h5-8,10-13,15-16,18H,9,14,17H2,1-4H3,(H,32,37)(H3,30,31,33,35)/b16-15+ |
| InChIKey | WFZQQPDXDMINCE-FOCLMDBBSA-N |
| XLogP | 3.96 |
| TPSA | 127.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|