C30H29N7O — CID 90273167
2-[3-[[2-amino-6-methyl-5-[(E)-2-pyridin-4-ylethenyl]pyrimidin-4-yl]amino]propyl]-5-methyl-3-phenylquinazolin-4-one (PubChem CID 90273167) has the molecular formula C30H29N7O and a molecular weight of 503.61 g/mol. Its IUPAC name is 2-[3-[[2-amino-6-methyl-5-[(E)-2-pyridin-4-ylethenyl]pyrimidin-4-yl]amino]propyl]-5-methyl-3-phenylquinazolin-4-one.
| Compound Name | 2-[3-[[2-amino-6-methyl-5-[(E)-2-pyridin-4-ylethenyl]pyrimidin-4-yl]amino]propyl]-5-methyl-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 90273167 |
| Molecular Formula | C30H29N7O |
| Molecular Weight | 503.61 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | 2-[3-[[2-amino-6-methyl-5-[(E)-2-pyridin-4-ylethenyl]pyrimidin-4-yl]amino]propyl]-5-methyl-3-phenylquinazolin-4-one |
| SMILES | Cc1nc(N)nc(NCCCc2nc3cccc(C)c3c(=O)n2-c2ccccc2)c1/C=C/c1ccncc1 |
| InChI | InChI=1S/C30H29N7O/c1-20-8-6-11-25-27(20)29(38)37(23-9-4-3-5-10-23)26(35-25)12-7-17-33-28-24(21(2)34-30(31)36-28)14-13-22-15-18-32-19-16-22/h3-6,8-11,13-16,18-19H,7,12,17H2,1-2H3,(H3,31,33,34,36)/b14-13+ |
| InChIKey | WIOPCZLCVRQNEB-BUHFOSPRSA-N |
| XLogP | 4.98 |
| TPSA | 111.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.61 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|