C20H22OP2 — CID 90278670
[(2E)-2-[(3-methyldibenzofuran-2-yl)methylidene]-3-methylidene-5-phosphanylpentyl]phosphane (PubChem CID 90278670) has the molecular formula C20H22OP2 and a molecular weight of 340.34 g/mol. Its IUPAC name is [(2E)-2-[(3-methyldibenzofuran-2-yl)methylidene]-3-methylidene-5-phosphanylpentyl]phosphane.
| Compound Name | [(2E)-2-[(3-methyldibenzofuran-2-yl)methylidene]-3-methylidene-5-phosphanylpentyl]phosphane |
|---|---|
| PubChem CID | 90278670 |
| Molecular Formula | C20H22OP2 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | [(2E)-2-[(3-methyldibenzofuran-2-yl)methylidene]-3-methylidene-5-phosphanylpentyl]phosphane |
| SMILES | C=C(CCP)/C(=C\c1cc2c(cc1C)oc1ccccc12)CP |
| InChI | InChI=1S/C20H22OP2/c1-13(7-8-22)16(12-23)10-15-11-18-17-5-3-4-6-19(17)21-20(18)9-14(15)2/h3-6,9-11H,1,7-8,12,22-23H2,2H3/b16-10- |
| InChIKey | IVGMBJQPPHEVTG-YBEGLDIGSA-N |
| XLogP | 5.97 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|