C20H24BNO4S — CID 90286251
methyl 1-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-thiazol-2-yl]cyclopropane-1-carboxylate (PubChem CID 90286251) has the molecular formula C20H24BNO4S and a molecular weight of 385.29 g/mol. Its IUPAC name is methyl 1-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-thiazol-2-yl]cyclopropane-1-carboxylate.
| Compound Name | methyl 1-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-thiazol-2-yl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 90286251 |
| Molecular Formula | C20H24BNO4S |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | methyl 1-[5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-thiazol-2-yl]cyclopropane-1-carboxylate |
| SMILES | COC(=O)C1(c2ncc(-c3ccc(B4OC(C)(C)C(C)(C)O4)cc3)s2)CC1 |
| InChI | InChI=1S/C20H24BNO4S/c1-18(2)19(3,4)26-21(25-18)14-8-6-13(7-9-14)15-12-22-16(27-15)20(10-11-20)17(23)24-5/h6-9,12H,10-11H2,1-5H3 |
| InChIKey | XNEINKKBSAYVTB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|