C17H21N3O3 — CID 90287937
N-[(2,4-dimethoxyphenyl)methyl]-5-(oxolan-3-yl)pyridazin-3-amine (PubChem CID 90287937) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-5-(oxolan-3-yl)pyridazin-3-amine.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-5-(oxolan-3-yl)pyridazin-3-amine |
|---|---|
| PubChem CID | 90287937 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-5-(oxolan-3-yl)pyridazin-3-amine |
| SMILES | COc1ccc(CNc2cc(C3CCOC3)cnn2)c(OC)c1 |
| InChI | InChI=1S/C17H21N3O3/c1-21-15-4-3-12(16(8-15)22-2)9-18-17-7-14(10-19-20-17)13-5-6-23-11-13/h3-4,7-8,10,13H,5-6,9,11H2,1-2H3,(H,18,20) |
| InChIKey | LLRUGCGCOJLKTN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |