C29H42N6O3SSi — CID 90288050
ethyl 1-[6-[(5-cyclopentyl-1,3,4-thiadiazol-2-yl)-(2-trimethylsilylethoxymethyl)amino]-1,5-naphthyridin-3-yl]piperidine-4-carboxylate (PubChem CID 90288050) has the molecular formula C29H42N6O3SSi and a molecular weight of 582.85 g/mol. Its IUPAC name is ethyl 1-[6-[(5-cyclopentyl-1,3,4-thiadiazol-2-yl)-(2-trimethylsilylethoxymethyl)amino]-1,5-naphthyridin-3-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[6-[(5-cyclopentyl-1,3,4-thiadiazol-2-yl)-(2-trimethylsilylethoxymethyl)amino]-1,5-naphthyridin-3-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 90288050 |
| Molecular Formula | C29H42N6O3SSi |
| Molecular Weight | 582.85 g/mol |
| Exact Mass | 582.28 |
| IUPAC Name | ethyl 1-[6-[(5-cyclopentyl-1,3,4-thiadiazol-2-yl)-(2-trimethylsilylethoxymethyl)amino]-1,5-naphthyridin-3-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2cnc3ccc(N(COCC[Si](C)(C)C)c4nnc(C5CCCC5)s4)nc3c2)CC1 |
| InChI | InChI=1S/C29H42N6O3SSi/c1-5-38-28(36)22-12-14-34(15-13-22)23-18-25-24(30-19-23)10-11-26(31-25)35(20-37-16-17-40(2,3)4)29-33-32-27(39-29)21-8-6-7-9-21/h10-11,18-19,21-22H,5-9,12-17,20H2,1-4H3 |
| InChIKey | JJEZCTVIHCFQNH-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 93.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.85 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|