C12H23BN2O3 — CID 90288479
2-(2-methoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-dihydropyrazole (PubChem CID 90288479) has the molecular formula C12H23BN2O3 and a molecular weight of 254.14 g/mol. Its IUPAC name is 2-(2-methoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-dihydropyrazole.
| Compound Name | 2-(2-methoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-dihydropyrazole |
|---|---|
| PubChem CID | 90288479 |
| Molecular Formula | C12H23BN2O3 |
| Molecular Weight | 254.14 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 2-(2-methoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-dihydropyrazole |
| SMILES | COCCN1C=C(B2OC(C)(C)C(C)(C)O2)CN1 |
| InChI | InChI=1S/C12H23BN2O3/c1-11(2)12(3,4)18-13(17-11)10-8-14-15(9-10)6-7-16-5/h9,14H,6-8H2,1-5H3 |
| InChIKey | OTMXYDWMOZBIME-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.14 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|