C18H14N6O2 — CID 90288925
7-(1-methylpyrazol-4-yl)-N-(3-nitrophenyl)-1,5-naphthyridin-2-amine (PubChem CID 90288925) has the molecular formula C18H14N6O2 and a molecular weight of 346.35 g/mol. Its IUPAC name is 7-(1-methylpyrazol-4-yl)-N-(3-nitrophenyl)-1,5-naphthyridin-2-amine.
| Compound Name | 7-(1-methylpyrazol-4-yl)-N-(3-nitrophenyl)-1,5-naphthyridin-2-amine |
|---|---|
| PubChem CID | 90288925 |
| Molecular Formula | C18H14N6O2 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 7-(1-methylpyrazol-4-yl)-N-(3-nitrophenyl)-1,5-naphthyridin-2-amine |
| SMILES | Cn1cc(-c2cnc3ccc(Nc4cccc([N+](=O)[O-])c4)nc3c2)cn1 |
| InChI | InChI=1S/C18H14N6O2/c1-23-11-13(10-20-23)12-7-17-16(19-9-12)5-6-18(22-17)21-14-3-2-4-15(8-14)24(25)26/h2-11H,1H3,(H,21,22) |
| InChIKey | PDFKVCZPTZNRBO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|