C29H48O5 — CID 90289883
[(2R)-3-methylbutan-2-yl] 2-[(3Z,5E)-5-[(2R,3R,3aS,7aS)-2-hydroxy-3-[(3R)-3-hydroxyoctyl]-1,2,3,3a,4,6,7,7a-octahydroinden-5-ylidene]penta-1,3-dien-2-yl]oxyacetate (PubChem CID 90289883) has the molecular formula C29H48O5 and a molecular weight of 476.70 g/mol. Its IUPAC name is [(2R)-3-methylbutan-2-yl] 2-[(3Z,5E)-5-[(2R,3R,3aS,7aS)-2-hydroxy-3-[(3R)-3-hydroxyoctyl]-1,2,3,3a,4,6,7,7a-octahydroinden-5-ylidene]penta-1,3-dien-2-yl]oxyacetate.
| Compound Name | [(2R)-3-methylbutan-2-yl] 2-[(3Z,5E)-5-[(2R,3R,3aS,7aS)-2-hydroxy-3-[(3R)-3-hydroxyoctyl]-1,2,3,3a,4,6,7,7a-octahydroinden-5-ylidene]penta-1,3-dien-2-yl]oxyacetate |
|---|---|
| PubChem CID | 90289883 |
| Molecular Formula | C29H48O5 |
| Molecular Weight | 476.70 g/mol |
| Exact Mass | 476.35 |
| IUPAC Name | [(2R)-3-methylbutan-2-yl] 2-[(3Z,5E)-5-[(2R,3R,3aS,7aS)-2-hydroxy-3-[(3R)-3-hydroxyoctyl]-1,2,3,3a,4,6,7,7a-octahydroinden-5-ylidene]penta-1,3-dien-2-yl]oxyacetate |
| SMILES | C=C(/C=C\C=C1/CC[C@H]2C[C@@H](O)[C@H](CC[C@H](O)CCCCC)[C@H]2C1)OCC(=O)O[C@H](C)C(C)C |
| InChI | InChI=1S/C29H48O5/c1-6-7-8-12-25(30)15-16-26-27-17-23(13-14-24(27)18-28(26)31)11-9-10-21(4)33-19-29(32)34-22(5)20(2)3/h9-11,20,22,24-28,30-31H,4,6-8,12-19H2,1-3,5H3/b10-9-,23-11+/t22-,24+,25-,26-,27+,28-/m1/s1 |
| InChIKey | GLZNGZOXVOZHMP-MEXBTEBESA-N |
| XLogP | 6.11 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.70 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|