C26H34N2O6 — CID 90290240
1-(2-hydroxyethyl)-N-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]piperidine-4-carboxamide (PubChem CID 90290240) has the molecular formula C26H34N2O6 and a molecular weight of 470.57 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-N-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]piperidine-4-carboxamide.
| Compound Name | 1-(2-hydroxyethyl)-N-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 90290240 |
| Molecular Formula | C26H34N2O6 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | 1-(2-hydroxyethyl)-N-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]piperidine-4-carboxamide |
| SMILES | COc1ccc(/C=C\c2cc(OC)c(OC)c(OC)c2)cc1NC(=O)C1CCN(CCO)CC1 |
| InChI | InChI=1S/C26H34N2O6/c1-31-22-8-7-18(5-6-19-16-23(32-2)25(34-4)24(17-19)33-3)15-21(22)27-26(30)20-9-11-28(12-10-20)13-14-29/h5-8,15-17,20,29H,9-14H2,1-4H3,(H,27,30)/b6-5- |
| InChIKey | SRRCXRAKODCXQM-WAYWQWQTSA-N |
| XLogP | 3.53 |
| TPSA | 89.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|