C17H27N3O5 — CID 90292012
4-tert-butyl-N-(2,2-diethoxyethyl)-2-nitrobenzohydrazide (PubChem CID 90292012) has the molecular formula C17H27N3O5 and a molecular weight of 353.42 g/mol. Its IUPAC name is 4-tert-butyl-N-(2,2-diethoxyethyl)-2-nitrobenzohydrazide.
| Compound Name | 4-tert-butyl-N-(2,2-diethoxyethyl)-2-nitrobenzohydrazide |
|---|---|
| PubChem CID | 90292012 |
| Molecular Formula | C17H27N3O5 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 4-tert-butyl-N-(2,2-diethoxyethyl)-2-nitrobenzohydrazide |
| SMILES | CCOC(CN(N)C(=O)c1ccc(C(C)(C)C)cc1[N+](=O)[O-])OCC |
| InChI | InChI=1S/C17H27N3O5/c1-6-24-15(25-7-2)11-19(18)16(21)13-9-8-12(17(3,4)5)10-14(13)20(22)23/h8-10,15H,6-7,11,18H2,1-5H3 |
| InChIKey | JJKLAMHIHVWXTJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 107.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|