C32H42N6O7SSi — CID 90293696
tert-butyl N-[3-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]pyrazolo[1,5-a]pyrimidin-5-yl]-N-[2-[methyl-(2-nitrophenyl)sulfonylamino]ethyl]carbamate (PubChem CID 90293696) has the molecular formula C32H42N6O7SSi and a molecular weight of 682.88 g/mol. Its IUPAC name is tert-butyl N-[3-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]pyrazolo[1,5-a]pyrimidin-5-yl]-N-[2-[methyl-(2-nitrophenyl)sulfonylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]pyrazolo[1,5-a]pyrimidin-5-yl]-N-[2-[methyl-(2-nitrophenyl)sulfonylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 90293696 |
| Molecular Formula | C32H42N6O7SSi |
| Molecular Weight | 682.88 g/mol |
| Exact Mass | 682.26 |
| IUPAC Name | tert-butyl N-[3-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]pyrazolo[1,5-a]pyrimidin-5-yl]-N-[2-[methyl-(2-nitrophenyl)sulfonylamino]ethyl]carbamate |
| SMILES | CN(CCN(C(=O)OC(C)(C)C)c1ccn2ncc(-c3cccc(O[Si](C)(C)C(C)(C)C)c3)c2n1)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C32H42N6O7SSi/c1-31(2,3)44-30(39)36(20-19-35(7)46(42,43)27-16-11-10-15-26(27)38(40)41)28-17-18-37-29(34-28)25(22-33-37)23-13-12-14-24(21-23)45-47(8,9)32(4,5)6/h10-18,21-22H,19-20H2,1-9H3 |
| InChIKey | ORSJBFMDPDJKEG-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 149.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.88 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|