C22H19N7O5S — CID 158618330
10-(2-nitrophenyl)sulfonyl-7,10,13,17,18,21-hexazatetracyclo[12.5.2.12,6.017,20]docosa-1(20),2(22),3,5,14(21),15,18-heptaen-8-one (PubChem CID 158618330) has the molecular formula C22H19N7O5S and a molecular weight of 493.51 g/mol. Its IUPAC name is 10-(2-nitrophenyl)sulfonyl-7,10,13,17,18,21-hexazatetracyclo[12.5.2.12,6.017,20]docosa-1(20),2(22),3,5,14(21),15,18-heptaen-8-one.
| Compound Name | 10-(2-nitrophenyl)sulfonyl-7,10,13,17,18,21-hexazatetracyclo[12.5.2.12,6.017,20]docosa-1(20),2(22),3,5,14(21),15,18-heptaen-8-one |
|---|---|
| PubChem CID | 158618330 |
| Molecular Formula | C22H19N7O5S |
| Molecular Weight | 493.51 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | 10-(2-nitrophenyl)sulfonyl-7,10,13,17,18,21-hexazatetracyclo[12.5.2.12,6.017,20]docosa-1(20),2(22),3,5,14(21),15,18-heptaen-8-one |
| SMILES | O=C1CN(S(=O)(=O)c2ccccc2[N+](=O)[O-])CCNc2ccn3ncc(c3n2)-c2cccc(c2)N1 |
| InChI | InChI=1S/C22H19N7O5S/c30-21-14-27(35(33,34)19-7-2-1-6-18(19)29(31)32)11-9-23-20-8-10-28-22(26-20)17(13-24-28)15-4-3-5-16(12-15)25-21/h1-8,10,12-13H,9,11,14H2,(H,23,26)(H,25,30) |
| InChIKey | OIJFMKQMRDPJIT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 151.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.51 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|