C29H33ClN6O7S — CID 90448137
tert-butyl N-[3-[3-[3-[3-chloropropyl-(2-nitrophenyl)sulfonylamino]phenyl]pyrazolo[1,5-a]pyrimidin-5-yl]oxypropyl]carbamate (PubChem CID 90448137) has the molecular formula C29H33ClN6O7S and a molecular weight of 645.14 g/mol. Its IUPAC name is tert-butyl N-[3-[3-[3-[3-chloropropyl-(2-nitrophenyl)sulfonylamino]phenyl]pyrazolo[1,5-a]pyrimidin-5-yl]oxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-[3-[3-chloropropyl-(2-nitrophenyl)sulfonylamino]phenyl]pyrazolo[1,5-a]pyrimidin-5-yl]oxypropyl]carbamate |
|---|---|
| PubChem CID | 90448137 |
| Molecular Formula | C29H33ClN6O7S |
| Molecular Weight | 645.14 g/mol |
| Exact Mass | 644.18 |
| IUPAC Name | tert-butyl N-[3-[3-[3-[3-chloropropyl-(2-nitrophenyl)sulfonylamino]phenyl]pyrazolo[1,5-a]pyrimidin-5-yl]oxypropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCOc1ccn2ncc(-c3cccc(N(CCCCl)S(=O)(=O)c4ccccc4[N+](=O)[O-])c3)c2n1 |
| InChI | InChI=1S/C29H33ClN6O7S/c1-29(2,3)43-28(37)31-15-8-18-42-26-13-17-34-27(33-26)23(20-32-34)21-9-6-10-22(19-21)35(16-7-14-30)44(40,41)25-12-5-4-11-24(25)36(38)39/h4-6,9-13,17,19-20H,7-8,14-16,18H2,1-3H3,(H,31,37) |
| InChIKey | XNJBRKXBEAIZNE-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 158.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.14 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|