C33H33ClF2N6O10S2 — CID 129023305
tert-butyl N-[[3-[4-[2-(2-chloro-5-fluoropyrimidin-4-yl)-5-fluorophenoxy]butyl-(2-nitrophenyl)sulfonylamino]-5-nitrophenyl]methyl-methyl-oxo-λ6-sulfanylidene]carbamate (PubChem CID 129023305) has the molecular formula C33H33ClF2N6O10S2 and a molecular weight of 811.24 g/mol. Its IUPAC name is tert-butyl N-[[3-[4-[2-(2-chloro-5-fluoropyrimidin-4-yl)-5-fluorophenoxy]butyl-(2-nitrophenyl)sulfonylamino]-5-nitrophenyl]methyl-methyl-oxo-λ6-sulfanylidene]carbamate.
| Compound Name | tert-butyl N-[[3-[4-[2-(2-chloro-5-fluoropyrimidin-4-yl)-5-fluorophenoxy]butyl-(2-nitrophenyl)sulfonylamino]-5-nitrophenyl]methyl-methyl-oxo-λ6-sulfanylidene]carbamate |
|---|---|
| PubChem CID | 129023305 |
| Molecular Formula | C33H33ClF2N6O10S2 |
| Molecular Weight | 811.24 g/mol |
| Exact Mass | 810.14 |
| IUPAC Name | tert-butyl N-[[3-[4-[2-(2-chloro-5-fluoropyrimidin-4-yl)-5-fluorophenoxy]butyl-(2-nitrophenyl)sulfonylamino]-5-nitrophenyl]methyl-methyl-oxo-λ6-sulfanylidene]carbamate |
| SMILES | CC(C)(C)OC(=O)N=S(C)(=O)Cc1cc(N(CCCCOc2cc(F)ccc2-c2nc(Cl)ncc2F)S(=O)(=O)c2ccccc2[N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C33H33ClF2N6O10S2/c1-33(2,3)52-32(43)39-53(4,48)20-21-15-23(18-24(16-21)41(44)45)40(54(49,50)29-10-6-5-9-27(29)42(46)47)13-7-8-14-51-28-17-22(35)11-12-25(28)30-26(36)19-37-31(34)38-30/h5-6,9-12,15-19H,7-8,13-14,20H2,1-4H3 |
| InChIKey | HIWHJMBAKIAPTF-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 214.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.24 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|